Chemical Component Summary | |
|---|---|
| Name | MESO-ERYTHRITOL |
| Identifiers | (2R,3S)-butane-1,2,3,4-tetrol |
| Formula | C4 H10 O4 |
| Molecular Weight | 122.12 |
| Type | NON-POLYMER |
| Isomeric SMILES | C([C@H]([C@H](CO)O)O)O |
| InChI | InChI=1S/C4H10O4/c5-1-3(7)4(8)2-6/h3-8H,1-2H2/t3-,4+ |
| InChIKey | UNXHWFMMPAWVPI-ZXZARUISSA-N |
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 18 |
| Chiral Atom Count | 2 |
| Bond Count | 17 |
| Aromatic Bond Count | 0 |
Drug Info: DrugBank
| DrugBank ID | DB04481 |
|---|---|
| Name | Erythritol |
| Groups | experimental |
| Description | Erythritol is a four-carbon sugar that is found in algae, fungi, and lichens. It is twice as sweet as sucrose and can be used as a coronary vasodilator. |
| Synonyms |
|
| Categories |
|
| CAS number | 149-32-6 |
Drug Targets
| Name | Target Sequence | Pharmacological Action | Actions |
|---|---|---|---|
| 5-methyltetrahydropteroyltriglutamate--homocysteine methyltransferase | MKAYAFGFPKIGEKREFKKALEDFWKGKITEEQFEEEMNKLRMYMVENYR... | unknown |
Drug Info/Drug Targets: DrugBank 3.0: a comprehensive resource for 'omics' research on drugs. Knox C, Law V, Jewison
T, Liu P, Ly S, Frolkis A, Pon A, Banco K, Mak C, Neveu V, Djoumbou Y, Eisner R, Guo AC, Wishart DS.
Nucleic Acids Res. 2011 Jan; 39 (Database issue):D1035-41. | PMID:21059682
Related Resource References
| Resource Name | Reference |
|---|---|
| PubChem | 222285 |
| ChEMBL | CHEMBL349605 |
| ChEBI | CHEBI:17113 |
| CCDC/CSD | SIRDIG, HESJOE |
