P7F
(2~{R})-2-[3-[[1,3-benzoxazol-2-yl-[3-(4-methoxyphenoxy)propyl]amino]methyl]phenoxy]butanoic acid
Find entries where: P7F
is present as a standalone ligand in 7 entries
Chemical Component Summary | |
|---|---|
| Name | (2~{R})-2-[3-[[1,3-benzoxazol-2-yl-[3-(4-methoxyphenoxy)propyl]amino]methyl]phenoxy]butanoic acid |
| Identifiers | (2~{R})-2-[3-[[1,3-benzoxazol-2-yl-[3-(4-methoxyphenoxy)propyl]amino]methyl]phenoxy]butanoic acid |
| Formula | C28 H30 N2 O6 |
| Molecular Weight | 490.548 |
| Type | NON-POLYMER |
| Isomeric SMILES | CC[C@H](C(=O)O)Oc1cccc(c1)CN(CCCOc2ccc(cc2)OC)c3nc4ccccc4o3 |
| InChI | InChI=1S/C28H30N2O6/c1-3-25(27(31)32)35-23-9-6-8-20(18-23)19-30(28-29-24-10-4-5-11-26(24)36-28)16-7-17-34-22-14-12-21(33-2)13-15-22/h4-6,8-15,18,25H,3,7,16-17,19H2,1-2H3,(H,31,32)/t25-/m1/s1 |
| InChIKey | ZHKNLJLMDFQVHJ-RUZDIDTESA-N |
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 66 |
| Chiral Atom Count | 1 |
| Bond Count | 69 |
| Aromatic Bond Count | 22 |
Drug Info: DrugBank
| DrugBank ID | DB15212 |
|---|---|
| Name | Pemafibrate |
| Groups | investigational |
| Description | Pemafibrate is under investigation in clinical trial NCT03350165 (A Study of Pemafibrate in Patients With Nonalcoholic Fatty Liver Disease (NAFLD)). |
| Synonyms | Pemafibrate |
| Categories |
|
| CAS number | 848259-27-8 |
Related Resource References
| Resource Name | Reference |
|---|---|
| Pharos | CHEMBL247951 |
| PubChem | 11526038 |
| ChEMBL | CHEMBL247951 |
| CCDC/CSD | VELPOV |
